Structure of PDB 4agi Chain D Binding Site BS05 |
|
|
Ligand ID | SFU |
InChI | InChI=1S/C7H14O4Se/c1-3-4(8)5(9)6(10)7(11-3)12-2/h3-10H,1-2H3/t3-,4+,5+,6-,7-/m0/s1 |
InChIKey | VHTNTJQSKJZERS-XUVCUMPTSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.352 | C[Se][C@@H]1O[C@@H](C)[C@@H](O)[C@@H](O)[C@@H]1O | OpenEye OEToolkits 1.6.1 | C[C@H]1[C@H]([C@H]([C@@H]([C@@H](O1)[Se]C)O)O)O | CACTVS 3.352 | C[Se][CH]1O[CH](C)[CH](O)[CH](O)[CH]1O | OpenEye OEToolkits 1.6.1 | CC1C(C(C(C(O1)[Se]C)O)O)O | ACDLabs 10.04 | OC1C(O)C(O)C(OC1[Se]C)C |
|
Formula | C7 H14 O4 Se |
Name | methyl 1-seleno-alpha-L-fucopyranoside; METHYL 6-DEOXY-1-SELENO-ALPHA-L-GALACTOPYRANOSIDE; methyl 1-seleno-alpha-L-fucoside; methyl 1-seleno-L-fucoside; methyl 1-seleno-fucoside |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 4agi Chain D Residue 950
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|