Structure of PDB 3t3m Chain C Binding Site BS05 |
|
|
Ligand ID | RC2 |
InChI | InChI=1S/C17H19N7O2S/c18-10-14(25)20-12-3-1-2-11(8-12)16-22-24-15(26)9-13(21-17(24)27-16)23-6-4-19-5-7-23/h1-3,8-9,19H,4-7,10,18H2,(H,20,25) |
InChIKey | ITNCYPYTFKVCFI-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | NCC(=O)Nc1cccc(c1)C2=NN3C(=O)C=C(N=C3S2)N4CCNCC4 | ACDLabs 12.01 | O=C(Nc4cccc(C1=NN2C(=O)C=C(N=C2S1)N3CCNCC3)c4)CN | OpenEye OEToolkits 1.7.2 | c1cc(cc(c1)NC(=O)CN)C2=NN3C(=O)C=C(N=C3S2)N4CCNCC4 |
|
Formula | C17 H19 N7 O2 S |
Name | N-{3-[5-oxo-7-(piperazin-1-yl)-5H-[1,3,4]thiadiazolo[3,2-a]pyrimidin-2-yl]phenyl}glycinamide |
ChEMBL | CHEMBL1472460 |
DrugBank | |
ZINC | ZINC000036381000
|
PDB chain | 3t3m Chain C Residue 5000
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|