Structure of PDB 6tgd Chain B Binding Site BS05 |
|
|
Ligand ID | N8Q |
InChI | InChI=1S/C12H14N4OS/c18-12-15-14-11(9-3-1-5-13-7-9)16(12)8-10-4-2-6-17-10/h1,3,5,7,10H,2,4,6,8H2,(H,15,18)/t10-/m0/s1 |
InChIKey | UPESTZWCQNGAJI-JTQLQIEISA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | S=C1NN=C(N1C[C@@H]2CCCO2)c3cccnc3 | OpenEye OEToolkits 2.0.7 | c1cc(cnc1)C2=NNC(=S)N2C[C@@H]3CCCO3 | CACTVS 3.385 | S=C1NN=C(N1C[CH]2CCCO2)c3cccnc3 | OpenEye OEToolkits 2.0.7 | c1cc(cnc1)C2=NNC(=S)N2CC3CCCO3 |
|
Formula | C12 H14 N4 O S |
Name | 4-[[(2~{S})-oxolan-2-yl]methyl]-3-pyridin-3-yl-1~{H}-1,2,4-triazole-5-thione |
ChEMBL | |
DrugBank | |
ZINC | ZINC000006926613
|
PDB chain | 6tgd Chain B Residue 305
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|