Structure of PDB 5uny Chain B Binding Site BS05 |
|
|
Ligand ID | M4R |
InChI | InChI=1S/C22H24N4O/c1-14-6-22(24)26-21-11-16(4-5-20(14)21)13-27-19-9-17(7-15(2)25-3)8-18(10-19)12-23/h4-6,8-11,15,25H,7,13H2,1-3H3,(H2,24,26)/t15-/m1/s1 |
InChIKey | PUGNZMCPLRURSU-OAHLLOKOSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | Cc1cc(nc2c1ccc(c2)COc3cc(cc(c3)C#N)CC(C)NC)N | CACTVS 3.385 | CN[C@H](C)Cc1cc(OCc2ccc3c(C)cc(N)nc3c2)cc(c1)C#N | OpenEye OEToolkits 2.0.6 | Cc1cc(nc2c1ccc(c2)COc3cc(cc(c3)C#N)C[C@@H](C)NC)N | CACTVS 3.385 | CN[CH](C)Cc1cc(OCc2ccc3c(C)cc(N)nc3c2)cc(c1)C#N | ACDLabs 12.01 | N#Cc1cc(CC(NC)C)cc(c1)OCc2cc3c(cc2)c(cc(N)n3)C |
|
Formula | C22 H24 N4 O |
Name | 3-[(2-amino-4-methylquinolin-7-yl)methoxy]-5-[(2R)-2-(methylamino)propyl]benzonitrile |
ChEMBL | CHEMBL4084387 |
DrugBank | |
ZINC |
|
PDB chain | 5uny Chain B Residue 803
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|