Structure of PDB 4kcl Chain B Binding Site BS05 |
|
|
Ligand ID | H44 |
InChI | InChI=1S/C25H25N5S2/c26-24(22-6-2-14-31-22)29-20-10-8-18(9-11-20)12-13-28-17-19-4-1-5-21(16-19)30-25(27)23-7-3-15-32-23/h1-11,14-16,28H,12-13,17H2,(H2,26,29)(H2,27,30) |
InChIKey | RWYJTZOFPFOVAE-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | N=C(Nc1ccc(CCNCc2cccc(NC(=N)c3sccc3)c2)cc1)c4sccc4 | OpenEye OEToolkits 1.7.6 | [H]/N=C(/c1cccs1)\Nc2ccc(cc2)CCNCc3cccc(c3)N/C(=N/[H])/c4cccs4 | OpenEye OEToolkits 1.7.6 | c1cc(cc(c1)NC(=N)c2cccs2)CNCCc3ccc(cc3)NC(=N)c4cccs4 | ACDLabs 12.01 | s1cccc1C(=[N@H])Nc2ccc(cc2)CCNCc3cc(ccc3)NC(=[N@H])c4sccc4 |
|
Formula | C25 H25 N5 S2 |
Name | N-(4-{2-[(3-{[(E)-imino(thiophen-2-yl)methyl]amino}benzyl)amino]ethyl}phenyl)thiophene-2-carboximidamide |
ChEMBL | CHEMBL3128246 |
DrugBank | |
ZINC | ZINC000098208984
|
PDB chain | 4kcl Chain B Residue 803
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|