Structure of PDB 4kci Chain B Binding Site BS05 |
|
|
Ligand ID | 1QE |
InChI | InChI=1S/C24H22N4S2/c25-23(21-9-3-13-29-21)27-19-7-1-5-17(15-19)11-12-18-6-2-8-20(16-18)28-24(26)22-10-4-14-30-22/h1-10,13-16H,11-12H2,(H2,25,27)(H2,26,28) |
InChIKey | MNMWXAHXXVXJBB-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | c1cc(cc(c1)NC(=N)c2cccs2)CCc3cccc(c3)NC(=N)c4cccs4 | OpenEye OEToolkits 1.7.6 | [H]/N=C(\Nc1cc(ccc1)CCc2cc(ccc2)N/C(=N/[H])/c3sccc3)/c4sccc4 | CACTVS 3.370 | N=C(Nc1cccc(CCc2cccc(NC(=N)c3sccc3)c2)c1)c4sccc4 | ACDLabs 12.01 | s1cccc1C(=[N@H])Nc2cccc(c2)CCc3cc(ccc3)NC(=[N@H])c4sccc4 |
|
Formula | C24 H22 N4 S2 |
Name | N,N'-(ethane-1,2-diyldibenzene-3,1-diyl)dithiophene-2-carboximidamide |
ChEMBL | CHEMBL3128241 |
DrugBank | |
ZINC | ZINC000098208009
|
PDB chain | 4kci Chain B Residue 803
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|