Structure of PDB 4eux Chain B Binding Site BS05 |
|
|
Ligand ID | HW1 |
InChI | InChI=1S/C22H33N5O/c1-15-8-18(26-21(23)10-15)6-4-3-5-7-28-20-14-25-13-17(20)12-19-9-16(2)11-22(24)27-19/h8-11,17,20,25H,3-7,12-14H2,1-2H3,(H2,23,26)(H2,24,27)/t17-,20+/m1/s1 |
InChIKey | WKAYHKZPKWNKSL-XLIONFOSSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | Cc1cc(nc(c1)N)CCCCCO[C@H]2CNC[C@H]2Cc3cc(cc(n3)N)C | ACDLabs 12.01 | O(CCCCCc1nc(N)cc(c1)C)C2C(CNC2)Cc3nc(N)cc(c3)C | CACTVS 3.370 | Cc1cc(N)nc(CCCCCO[CH]2CNC[CH]2Cc3cc(C)cc(N)n3)c1 | CACTVS 3.370 | Cc1cc(N)nc(CCCCCO[C@H]2CNC[C@H]2Cc3cc(C)cc(N)n3)c1 | OpenEye OEToolkits 1.7.6 | Cc1cc(nc(c1)N)CCCCCOC2CNCC2Cc3cc(cc(n3)N)C |
|
Formula | C22 H33 N5 O |
Name | 6-[5-({(3R,4R)-4-[(6-amino-4-methylpyridin-2-yl)methyl]pyrrolidin-3-yl}oxy)pentyl]-4-methylpyridin-2-amine |
ChEMBL | |
DrugBank | |
ZINC | ZINC000095921098
|
PDB chain | 4eux Chain B Residue 804
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|