Structure of PDB 4cao Chain B Binding Site BS05 |
|
|
Ligand ID | M46 |
InChI | InChI=1S/C20H22FN3/c21-18-5-1-3-15(13-18)4-2-11-23-12-10-16-6-7-17-8-9-20(22)24-19(17)14-16/h1,3,5-9,13-14,23H,2,4,10-12H2,(H2,22,24) |
InChIKey | ZCQVAHWJMSLTRU-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Nc1ccc2ccc(CCNCCCc3cccc(F)c3)cc2n1 | OpenEye OEToolkits 1.9.2 | c1cc(cc(c1)F)CCCNCCc2ccc3ccc(nc3c2)N | ACDLabs 12.01 | Fc1cccc(c1)CCCNCCc2cc3nc(ccc3cc2)N |
|
Formula | C20 H22 F N3 |
Name | 7-[2-[3-(3-fluorophenyl)propylamino]ethyl]quinolin-2-amine |
ChEMBL | CHEMBL3139616 |
DrugBank | |
ZINC | ZINC000098209148
|
PDB chain | 4cao Chain B Residue 800
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|