Structure of PDB 3wv3 Chain B Binding Site BS05 |
|
|
Ligand ID | WLL |
InChI | InChI=1S/C15H13N3O3S/c1-21-10-4-2-3-9(7-10)8-16-14(20)12-17-13(19)11-5-6-22-15(11)18-12/h2-7H,8H2,1H3,(H,16,20)(H,17,18,19) |
InChIKey | JBLVGKQIAQNLEM-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | COc1cccc(CNC(=O)C2=Nc3sccc3C(=O)N2)c1 | ACDLabs 12.01 | O=C(C2=Nc1sccc1C(=O)N2)NCc3cccc(OC)c3 | OpenEye OEToolkits 1.7.6 | COc1cccc(c1)CNC(=O)C2=Nc3c(ccs3)C(=O)N2 |
|
Formula | C15 H13 N3 O3 S |
Name | N-(3-methoxybenzyl)-4-oxo-3,4-dihydrothieno[2,3-d]pyrimidine-2-carboxamide |
ChEMBL | CHEMBL3337881 |
DrugBank | |
ZINC | ZINC000098209577
|
PDB chain | 3wv3 Chain B Residue 308
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|