Structure of PDB 3svp Chain B Binding Site BS05 |
|
|
Ligand ID | JK5 |
InChI | InChI=1S/C21H26ClF3N4O/c1-13-4-18(29-20(26)5-13)6-14-10-28-11-19(14)30-3-2-27-12-21(24,25)15-7-16(22)9-17(23)8-15/h4-5,7-9,14,19,27-28H,2-3,6,10-12H2,1H3,(H2,26,29)/t14-,19+/m1/s1 |
InChIKey | WCMZHGFWPJYQKM-KUHUBIRLSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | Fc1cc(cc(Cl)c1)C(F)(F)CNCCOC2C(CNC2)Cc3nc(N)cc(c3)C | OpenEye OEToolkits 1.7.2 | Cc1cc(nc(c1)N)C[C@@H]2CNC[C@@H]2OCCNCC(c3cc(cc(c3)Cl)F)(F)F | CACTVS 3.370 | Cc1cc(N)nc(C[CH]2CNC[CH]2OCCNCC(F)(F)c3cc(F)cc(Cl)c3)c1 | CACTVS 3.370 | Cc1cc(N)nc(C[C@@H]2CNC[C@@H]2OCCNCC(F)(F)c3cc(F)cc(Cl)c3)c1 | OpenEye OEToolkits 1.7.2 | Cc1cc(nc(c1)N)CC2CNCC2OCCNCC(c3cc(cc(c3)Cl)F)(F)F |
|
Formula | C21 H26 Cl F3 N4 O |
Name | 6-{[(3R,4R)-4-(2-{[2-(3-chloro-5-fluorophenyl)-2,2-difluoroethyl]amino}ethoxy)pyrrolidin-3-yl]methyl}-4-methylpyridin-2-amine |
ChEMBL | CHEMBL1824858 |
DrugBank | |
ZINC | ZINC000072180949
|
PDB chain | 3svp Chain B Residue 800
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|