Structure of PDB 3nm0 Chain B Binding Site BS05 |
|
|
Ligand ID | 3XE |
InChI | InChI=1S/C21H32F2N4O/c1-15-9-18(27-20(24)10-15)11-16-12-26-13-19(16)28-8-7-25-14-21(22,23)17-5-3-2-4-6-17/h2-6,15-16,18-19,25-26H,7-14H2,1H3,(H2,24,27)/t15-,16+,18-,19-/m0/s1 |
InChIKey | DAHQXGAQQOLJFX-NBMJBFSESA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.0 | CC1CC(N=C(C1)N)CC2CNCC2OCCNCC(c3ccccc3)(F)F | CACTVS 3.370 | C[C@H]1C[C@@H](C[C@@H]2CNC[C@@H]2OCCNCC(F)(F)c3ccccc3)N=C(N)C1 | OpenEye OEToolkits 1.7.0 | C[C@H]1C[C@H](N=C(C1)N)C[C@@H]2CNC[C@@H]2OCCNCC(c3ccccc3)(F)F | CACTVS 3.370 | C[CH]1C[CH](C[CH]2CNC[CH]2OCCNCC(F)(F)c3ccccc3)N=C(N)C1 | ACDLabs 12.01 | FC(F)(c1ccccc1)CNCCOC2C(CNC2)CC3N=C(N)CC(C)C3 |
|
Formula | C21 H32 F2 N4 O |
Name | (4S,6S)-6-{[(3R,4R)-4-{2-[(2,2-difluoro-2-phenylethyl)amino]ethoxy}pyrrolidin-3-yl]methyl}-4-methyl-3,4,5,6-tetrahydropyridin-2-amine |
ChEMBL | |
DrugBank | |
ZINC | ZINC000064746420
|
PDB chain | 3nm0 Chain B Residue 800
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|