Structure of PDB 3dqr Chain B Binding Site BS05 |
|
|
Ligand ID | JI2 |
InChI | InChI=1S/C12H21N5/c13-4-5-16-11-8-15-7-9(11)6-10-2-1-3-12(14)17-10/h1-3,9,11,15-16H,4-8,13H2,(H2,14,17)/t9-,11+/m0/s1 |
InChIKey | BETYXZSFUFTOLC-GXSJLCMTSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.341 | NCCN[CH]1CNC[CH]1Cc2cccc(N)n2 | OpenEye OEToolkits 1.5.0 | c1cc(nc(c1)N)C[C@H]2CNC[C@H]2NCCN | OpenEye OEToolkits 1.5.0 | c1cc(nc(c1)N)CC2CNCC2NCCN | CACTVS 3.341 | NCCN[C@@H]1CNC[C@@H]1Cc2cccc(N)n2 | ACDLabs 10.04 | n1c(N)cccc1CC2CNCC2NCCN |
|
Formula | C12 H21 N5 |
Name | N-{(3S,4S)-4-[(6-aminopyridin-2-yl)methyl]pyrrolidin-3-yl}ethane-1,2-diamine; (+-)-N1-{cis-4'-[(6"-aminopyridin-2"-yl)methyl]pyrrolidin-3'-yl}ethane-1,2-diamine |
ChEMBL | CHEMBL510760 |
DrugBank | |
ZINC | ZINC000024957197
|
PDB chain | 3dqr Chain B Residue 800
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|