Structure of PDB 6h4z Chain A Binding Site BS05 |
|
|
Ligand ID | FQ5 |
InChI | InChI=1S/C23H23ClN6O/c24-19-3-1-2-18(12-19)17-6-10-29(11-7-17)9-5-16-13-28-30(14-16)22-21-20(4-8-25-22)23(31)27-15-26-21/h1-4,8,12-15,17H,5-7,9-11H2,(H,26,27,31) |
InChIKey | LDSDVQOOEYCWQS-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | c1cc(cc(c1)Cl)C2CCN(CC2)CCc3cnn(c3)c4c5c(ccn4)C(=O)NC=N5 | CACTVS 3.385 | Clc1cccc(c1)C2CCN(CC2)CCc3cnn(c3)c4nccc5C(=O)NC=Nc45 |
|
Formula | C23 H23 Cl N6 O |
Name | 8-[4-[2-[4-(3-chlorophenyl)piperidin-1-yl]ethyl]pyrazol-1-yl]-3~{H}-pyrido[3,4-d]pyrimidin-4-one |
ChEMBL | CHEMBL3774537 |
DrugBank | |
ZINC | ZINC000653728054
|
PDB chain | 6h4z Chain A Residue 805
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
Global view | Local view | Structure summary |
[Spin on]
[Spin off]
[Reset]
[High quality]
[Low quality]
[White background]
[Black background]
|
[Spin on]
[Spin off]
[Reset]
[High quality]
[Low quality]
[White background]
[Black background]
|
PDB | 6h4z C8-substituted pyrido[3,4-d]pyrimidin-4(3H)-ones: Studies towards the identification of potent, cell penetrant Jumonji C domain containing histone lysine demethylase 4 subfamily (KDM4) inhibitors, compound profiling in cell-based target engagement assays. |
Resolution | 2.3 Å |
Binding residue (original residue number in PDB) | Y425 D428 C480 W486 Y488 F496 H499 E501 K517 W519 H587 |
Binding residue (residue number reindexed from 1) | Y129 D132 C183 W189 Y191 F199 H202 E204 K220 W222 H290 |
Annotation score | 1 |
Binding affinity | MOAD: Ki=0.002uM PDBbind-CN: -logKd/Ki=7.64,IC50=0.023uM BindingDB: EC50=600nM,Ki=2.0nM,IC50=23nM |
|
|
|
|