Structure of PDB 5few Chain A Binding Site BS05 |
|
|
Ligand ID | 41K |
InChI | InChI=1S/C6H9NO4S/c1-6(5(10)11)7-3(2-12-6)4(8)9/h3,7H,2H2,1H3,(H,8,9)(H,10,11)/t3-,6+/m0/s1 |
InChIKey | JCAKCGQZNBEITC-BBIVZNJYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | C[C@]1(N[C@@H](CS1)C(O)=O)C(O)=O | CACTVS 3.385 | C[C]1(N[CH](CS1)C(O)=O)C(O)=O | OpenEye OEToolkits 1.9.2 | CC1(NC(CS1)C(=O)O)C(=O)O | OpenEye OEToolkits 1.9.2 | C[C@]1(N[C@@H](CS1)C(=O)O)C(=O)O | ACDLabs 12.01 | O=C(O)C1(SCC(C(=O)O)N1)C |
|
Formula | C6 H9 N O4 S |
Name | (2R,4R)-2-methyl-1,3-thiazolidine-2,4-dicarboxylic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000001701053
|
PDB chain | 5few Chain A Residue 412
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|