Structure of PDB 4wk7 Chain A Binding Site BS05 |
|
|
Ligand ID | 3PQ |
InChI | InChI=1S/C13H14ClN3O4/c1-13(11(19)16-12(20)17-13)7-15-10(18)6-21-9-4-2-8(14)3-5-9/h2-5H,6-7H2,1H3,(H,15,18)(H2,16,17,19,20)/t13-/m1/s1 |
InChIKey | LNIRXDCIYOBRPL-CYBMUJFWSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | C[C]1(CNC(=O)COc2ccc(Cl)cc2)NC(=O)NC1=O | ACDLabs 12.01 | O=C(NCC1(C(=O)NC(=O)N1)C)COc2ccc(Cl)cc2 | CACTVS 3.385 | C[C@]1(CNC(=O)COc2ccc(Cl)cc2)NC(=O)NC1=O | OpenEye OEToolkits 1.9.2 | CC1(C(=O)NC(=O)N1)CNC(=O)COc2ccc(cc2)Cl | OpenEye OEToolkits 1.9.2 | C[C@]1(C(=O)NC(=O)N1)CNC(=O)COc2ccc(cc2)Cl |
|
Formula | C13 H14 Cl N3 O4 |
Name | 2-(4-chlorophenoxy)-N-{[(4R)-4-methyl-2,5-dioxoimidazolidin-4-yl]methyl}acetamide |
ChEMBL | CHEMBL3358151 |
DrugBank | |
ZINC | ZINC000219659463
|
PDB chain | 4wk7 Chain A Residue 505
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.4.24.82: ADAMTS-4 endopeptidase. |
|
|
|