Structure of PDB 4qkz Chain A Binding Site BS05 |
|
|
Ligand ID | QZK |
InChI | InChI=1S/C13H15NO8P2S/c15-23(16,17)13(24(18,19)20)14-25(21,22)12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-9,13-14H,(H2,15,16,17)(H2,18,19,20) |
InChIKey | SZOCMHFDKYEXMY-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | O[P](O)(=O)C(N[S](=O)(=O)c1ccc(cc1)c2ccccc2)[P](O)(O)=O | OpenEye OEToolkits 1.7.6 | c1ccc(cc1)c2ccc(cc2)S(=O)(=O)NC(P(=O)(O)O)P(=O)(O)O | ACDLabs 12.01 | O=S(=O)(NC(P(=O)(O)O)P(=O)(O)O)c2ccc(c1ccccc1)cc2 |
|
Formula | C13 H15 N O8 P2 S |
Name | {[(biphenyl-4-ylsulfonyl)amino]methanediyl}bis(phosphonic acid) |
ChEMBL | CHEMBL3291009 |
DrugBank | |
ZINC | ZINC000169351260
|
PDB chain | 4qkz Chain A Residue 305
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|