Structure of PDB 4m5i Chain A Binding Site BS05 |
|
|
Ligand ID | YH6 |
InChI | InChI=1S/C14H13N5O2S/c1-7-2-4-8(5-3-7)9(20)6-22-14-16-10-11(18-14)17-13(15)19-12(10)21/h2-5H,6H2,1H3,(H4,15,16,17,18,19,21) |
InChIKey | HIGGTDYQNPXEFT-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=C(c1ccc(cc1)C)CSc3nc2N=C(N)NC(=O)c2n3 | CACTVS 3.385 | Cc1ccc(cc1)C(=O)CSc2[nH]c3C(=O)NC(=Nc3n2)N | OpenEye OEToolkits 1.7.6 | Cc1ccc(cc1)C(=O)CSc2[nH]c3c(n2)N=C(NC3=O)N |
|
Formula | C14 H13 N5 O2 S |
Name | 2-amino-8-{[2-(4-methylphenyl)-2-oxoethyl]sulfanyl}-1,7-dihydro-6H-purin-6-one |
ChEMBL | CHEMBL3233203 |
DrugBank | |
ZINC | ZINC000004639536
|
PDB chain | 4m5i Chain A Residue 205
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
R82 R92 D95 D97 |
Catalytic site (residue number reindexed from 1) |
R83 R93 D96 D98 |
Enzyme Commision number |
2.7.6.3: 2-amino-4-hydroxy-6-hydroxymethyldihydropteridine diphosphokinase. |
|
|
|