Structure of PDB 1gkc Chain A Binding Site BS05 |
|
|
Ligand ID | NFH |
InChI | InChI=1S/C15H29N3O4/c1-10(2)7-11(8-18(22)9-19)13(20)17-12(14(21)16-6)15(3,4)5/h9-12,22H,7-8H2,1-6H3,(H,16,21)(H,17,20)/t11-,12-/m1/s1 |
InChIKey | YRLGSCVOSAUJJE-VXGBXAGGSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.0 | CC(C)C[C@H](CN(C=O)O)C(=O)N[C@H](C(=O)NC)C(C)(C)C | OpenEye OEToolkits 1.7.0 | CC(C)CC(CN(C=O)O)C(=O)NC(C(=O)NC)C(C)(C)C | ACDLabs 12.01 | O=CN(O)CC(C(=O)NC(C(=O)NC)C(C)(C)C)CC(C)C | CACTVS 3.370 | CNC(=O)[C@@H](NC(=O)[C@H](CC(C)C)CN(O)C=O)C(C)(C)C | CACTVS 3.370 | CNC(=O)[CH](NC(=O)[CH](CC(C)C)CN(O)C=O)C(C)(C)C |
|
Formula | C15 H29 N3 O4 |
Name | N~2~-[(2R)-2-{[formyl(hydroxy)amino]methyl}-4-methylpentanoyl]-N,3-dimethyl-L-valinamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000012080867
|
PDB chain | 1gkc Chain A Residue 1448
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|