Structure of PDB 3cwb Chain P Binding Site BS04 |
|
|
Ligand ID | ICX |
InChI | InChI=1S/C23H25IN2O4/c1-30-22(28)16-26-21(27)5-3-2-4-14-25-23(29)19-10-6-17(7-11-19)15-18-8-12-20(24)13-9-18/h4,6-14H,2-3,5,15-16H2,1H3,(H,25,29)(H,26,27)/b14-4- |
InChIKey | GJXNVOLPXGNHOU-CPSFFCFKSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | COC(=O)CNC(=O)CCCC=CNC(=O)c1ccc(cc1)Cc2ccc(cc2)I | CACTVS 3.341 | COC(=O)CNC(=O)CCC\C=C/NC(=O)c1ccc(Cc2ccc(I)cc2)cc1 | ACDLabs 10.04 | Ic1ccc(cc1)Cc2ccc(C(=O)N\C=C/CCCC(=O)NCC(=O)OC)cc2 | OpenEye OEToolkits 1.5.0 | COC(=O)CNC(=O)CCC\C=C/NC(=O)c1ccc(cc1)Cc2ccc(cc2)I | CACTVS 3.341 | COC(=O)CNC(=O)CCCC=CNC(=O)c1ccc(Cc2ccc(I)cc2)cc1 |
|
Formula | C23 H25 I N2 O4 |
Name | methyl N-[(5Z)-6-({[4-(4-iodobenzyl)phenyl]carbonyl}amino)hex-5-enoyl]glycinate |
ChEMBL | CHEMBL520875 |
DrugBank | |
ZINC | ZINC000040424060
|
PDB chain | 3cwb Chain P Residue 3001
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|