Structure of PDB 5c2t Chain F Binding Site BS04 |
|
|
Ligand ID | 4YP |
InChI | InChI=1S/C18H25NO3/c1-11(2)7-6-8-12(3)9-10-14-13(4)16(20)15(19)18(22-5)17(14)21/h7,9H,6,8,10,19H2,1-5H3/b12-9+ |
InChIKey | WWFOMDYINFXROF-FMIVXFBMSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.9.2 | CC1=C(C(=O)C(=C(C1=O)N)OC)CC=C(C)CCC=C(C)C | CACTVS 3.385 | COC1=C(N)C(=O)C(=C(CC=C(C)CCC=C(C)C)C1=O)C | OpenEye OEToolkits 1.9.2 | CC1=C(C(=O)C(=C(C1=O)N)OC)C/C=C(\C)/CCC=C(C)C | CACTVS 3.385 | COC1=C(N)C(=O)C(=C(C/C=C(C)/CCC=C(C)C)C1=O)C | ACDLabs 12.01 | CC(=[C@H]CCC(=[C@H]CC=1C(C(=C(C(C=1C)=O)N)OC)=O)C)C |
|
Formula | C18 H25 N O3 |
Name | 2-amino-5-[(2E)-3,7-dimethylocta-2,6-dien-1-yl]-3-methoxy-6-methylcyclohexa-2,5-diene-1,4-dione; rhodoquinone-2 |
ChEMBL | |
DrugBank | |
ZINC | ZINC000263621203
|
PDB chain | 5c2t Chain G Residue 202
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
1.3.5.1: succinate dehydrogenase. |
|
|
|