Structure of PDB 3qu8 Chain E Binding Site BS04 |
|
|
Ligand ID | CM5 |
InChI | InChI=1S/C23H42O11/c24-11-14-16(26)17(27)19(29)23(32-14)34-21-15(12-25)33-22(20(30)18(21)28)31-10-6-2-5-9-13-7-3-1-4-8-13/h13-30H,1-12H2/t14-,15-,16-,17+,18-,19-,20-,21-,22-,23-/m1/s1 |
InChIKey | RVTGFZGNOSKUDA-ZNGNCRBCSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 10.04 | O(CCCCCC1CCCCC1)C3OC(C(OC2OC(CO)C(O)C(O)C2O)C(O)C3O)CO | OpenEye OEToolkits 1.5.0 | C1CCC(CC1)CCCCCO[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O[C@@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)O)O | CACTVS 3.341 | OC[CH]1O[CH](O[CH]2[CH](O)[CH](O)[CH](OCCCCCC3CCCCC3)O[CH]2CO)[CH](O)[CH](O)[CH]1O | CACTVS 3.341 | OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O)[C@H](OCCCCCC3CCCCC3)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O | OpenEye OEToolkits 1.5.0 | C1CCC(CC1)CCCCCOC2C(C(C(C(O2)CO)OC3C(C(C(C(O3)CO)O)O)O)O)O |
|
Formula | C23 H42 O11 |
Name | 5-CYCLOHEXYL-1-PENTYL-BETA-D-MALTOSIDE; 5-CYCLOHEXYLPENTYL 4-O-ALPHA-D-GLUCOPYRANOSYL-BETA-D-GLUCOPYRANOSIDE; CYMAL-5 |
ChEMBL | |
DrugBank | DB04664 |
ZINC | ZINC000014881288
|
PDB chain | 3qu8 Chain E Residue 605
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
Molecular Function |
GO:0004497 |
monooxygenase activity |
GO:0005506 |
iron ion binding |
GO:0008390 |
testosterone 16-alpha-hydroxylase activity |
GO:0008392 |
arachidonate epoxygenase activity |
GO:0016705 |
oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen |
GO:0016712 |
oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced flavin or flavoprotein as one donor, and incorporation of one atom of oxygen |
GO:0020037 |
heme binding |
GO:0046872 |
metal ion binding |
GO:0062184 |
testosterone 16-beta-hydroxylase activity |
GO:0062187 |
anandamide 8,9 epoxidase activity |
GO:0062188 |
anandamide 11,12 epoxidase activity |
GO:0062189 |
anandamide 14,15 epoxidase activity |
GO:0101021 |
estrogen 2-hydroxylase activity |
|
|