Structure of PDB 6nh3 Chain D Binding Site BS04 |
|
|
Ligand ID | KL4 |
InChI | InChI=1S/C20H26FN3/c1-14-9-19(24-20(22)10-14)7-5-16-11-15(12-17(21)13-16)4-6-18-3-2-8-23-18/h9-13,18,23H,2-8H2,1H3,(H2,22,24)/t18-/m1/s1 |
InChIKey | PTOVOAJZRWYLQM-GOSISDBHSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | Cc1cc(nc(c1)N)CCc2cc(cc(c2)F)CC[C@H]3CCCN3 | CACTVS 3.385 | Cc1cc(N)nc(CCc2cc(F)cc(CC[C@H]3CCCN3)c2)c1 | ACDLabs 12.01 | c1(nc(cc(c1)C)CCc2cc(cc(c2)F)CCC3NCCC3)N | OpenEye OEToolkits 2.0.6 | Cc1cc(nc(c1)N)CCc2cc(cc(c2)F)CCC3CCCN3 | CACTVS 3.385 | Cc1cc(N)nc(CCc2cc(F)cc(CC[CH]3CCCN3)c2)c1 |
|
Formula | C20 H26 F N3 |
Name | 6-[2-(3-fluoro-5-{2-[(2S)-pyrrolidin-2-yl]ethyl}phenyl)ethyl]-4-methylpyridin-2-amine |
ChEMBL | CHEMBL4562481 |
DrugBank | |
ZINC |
|
PDB chain | 6nh3 Chain D Residue 502
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|