Structure of PDB 7lu7 Chain CCC Binding Site BS04 |
|
|
Ligand ID | 5PK |
InChI | InChI=1S/C18H22N2O/c21-18(13-6-2-1-3-7-13)10-16-14-8-4-5-9-15(14)17-11-19-12-20(16)17/h4-5,8-9,11-13,16,18,21H,1-3,6-7,10H2/t16-,18+/m0/s1 |
InChIKey | YTRRAUACYORZLX-FUHWJXTLSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | O[C@H](C[C@@H]1n2cncc2c3ccccc13)C4CCCCC4 | OpenEye OEToolkits 2.0.4 | c1ccc2c(c1)-c3cncn3[C@H]2C[C@H](C4CCCCC4)O | OpenEye OEToolkits 2.0.4 | c1ccc2c(c1)-c3cncn3C2CC(C4CCCCC4)O | CACTVS 3.385 | O[CH](C[CH]1n2cncc2c3ccccc13)C4CCCCC4 |
|
Formula | C18 H22 N2 O |
Name | (1~{R})-1-cyclohexyl-2-[(5~{S})-5~{H}-imidazo[1,5-b]isoindol-5-yl]ethanol |
ChEMBL | CHEMBL3752711 |
DrugBank | |
ZINC | ZINC000095616584
|
PDB chain | 7lu7 Chain DDD Residue 403
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
1.13.11.11: tryptophan 2,3-dioxygenase. |
|
|
|