Structure of PDB 7dp8 Chain C Binding Site BS04 |
|
|
Ligand ID | G2X |
InChI | InChI=1S/C18H18ClF5N6O/c1-9(18(22,23)24)28-16-14(15(19)29-17-26-8-27-30(16)17)13-11(20)6-10(7-12(13)21)31-5-3-4-25-2/h6-9,25,28H,3-5H2,1-2H3/t9-/m0/s1 |
InChIKey | ZUZPCOQWSYNWLU-VIFPVBQESA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CNCCCOc1cc(F)c(c(F)c1)c2c(Cl)nc3ncnn3c2N[CH](C)C(F)(F)F | CACTVS 3.385 | CNCCCOc1cc(F)c(c(F)c1)c2c(Cl)nc3ncnn3c2N[C@@H](C)C(F)(F)F | OpenEye OEToolkits 2.0.7 | CC(C(F)(F)F)Nc1c(c(nc2n1ncn2)Cl)c3c(cc(cc3F)OCCCNC)F | OpenEye OEToolkits 2.0.7 | C[C@@H](C(F)(F)F)Nc1c(c(nc2n1ncn2)Cl)c3c(cc(cc3F)OCCCNC)F |
|
Formula | C18 H18 Cl F5 N6 O |
Name | 6-[2,6-bis(fluoranyl)-4-[3-(methylamino)propoxy]phenyl]-5-chloranyl-N-[(2S)-1,1,1-tris(fluoranyl)propan-2-yl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
ChEMBL | CHEMBL1182714 |
DrugBank | DB12533 |
ZINC | ZINC000013981125
|
PDB chain | 7dp8 Chain C Residue 605
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|