Structure of PDB 6nu6 Chain C Binding Site BS04 |
|
|
Ligand ID | L1Y |
InChI | InChI=1S/C15H16O5/c16-13(17)8-11-2-1-3-12(11)14(18)9-4-6-10(7-5-9)15(19)20/h4-7,11-12H,1-3,8H2,(H,16,17)(H,19,20)/t11-,12+/m1/s1 |
InChIKey | AIBKYDBZFDNIIN-NEPJUHHUSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | OC(=O)C[CH]1CCC[CH]1C(=O)c2ccc(cc2)C(O)=O | OpenEye OEToolkits 2.0.7 | c1cc(ccc1C(=O)[C@H]2CCC[C@@H]2CC(=O)O)C(=O)O | CACTVS 3.385 | OC(=O)C[C@H]1CCC[C@@H]1C(=O)c2ccc(cc2)C(O)=O | OpenEye OEToolkits 2.0.7 | c1cc(ccc1C(=O)C2CCCC2CC(=O)O)C(=O)O | ACDLabs 12.01 | C1(C(CCC1)CC(=O)O)C(c2ccc(cc2)C(O)=O)=O |
|
Formula | C15 H16 O5 |
Name | 4-[(1S,2R)-2-(carboxymethyl)cyclopentane-1-carbonyl]benzoic acid |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6nu6 Chain D Residue 302
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|