Structure of PDB 6hp0 Chain C Binding Site BS04 |
|
|
Ligand ID | GJT |
InChI | InChI=1S/C17H26N4O5/c1-4-13(5-2)26-15-7-11(17(24)25)6-14(16(15)18-10(3)23)21-8-12(9-22)19-20-21/h7-8,13-16,22H,4-6,9H2,1-3H3,(H,18,23)(H,24,25)/t14-,15+,16+/m0/s1 |
InChIKey | IPVDZUUVRPUAMB-ARFHVFGLSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CCC(CC)O[CH]1C=C(C[CH]([CH]1NC(C)=O)n2cc(CO)nn2)C(O)=O | CACTVS 3.385 | CCC(CC)O[C@@H]1C=C(C[C@@H]([C@H]1NC(C)=O)n2cc(CO)nn2)C(O)=O | OpenEye OEToolkits 2.0.6 | CCC(CC)O[C@@H]1C=C(C[C@@H]([C@H]1NC(=O)C)n2cc(nn2)CO)C(=O)O | OpenEye OEToolkits 2.0.6 | CCC(CC)OC1C=C(CC(C1NC(=O)C)n2cc(nn2)CO)C(=O)O |
|
Formula | C17 H26 N4 O5 |
Name | (3~{R},4~{R},5~{S})-4-acetamido-5-[4-(hydroxymethyl)-1,2,3-triazol-1-yl]-3-pentan-3-yloxy-cyclohexene-1-carboxylic acid |
ChEMBL | CHEMBL4468251 |
DrugBank | |
ZINC |
|
PDB chain | 6hp0 Chain C Residue 503
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|