Structure of PDB 3l8h Chain C Binding Site BS04 |
|
|
Ligand ID | FX1 |
InChI | InChI=1S/C6H10O6/c7-1-3-4(9)5(10)6(11,2-8)12-3/h3,5,7-8,10-11H,1-2H2/t3-,5+,6-/m1/s1 |
InChIKey | LAWYCIPOFYQBDZ-PQLUHFTBSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.352 | OC[CH]1O[C](O)(CO)[CH](O)C1=O | OpenEye OEToolkits 1.7.0 | C([C@@H]1C(=O)[C@@H]([C@](O1)(CO)O)O)O | CACTVS 3.352 | OC[C@H]1O[C@](O)(CO)[C@@H](O)C1=O | OpenEye OEToolkits 1.7.0 | C(C1C(=O)C(C(O1)(CO)O)O)O |
|
Formula | C6 H10 O6 |
Name | beta-D-threo-hexo-2,4-diulo-2,5-furanose; beta-D-threo-hexo-2,4-diulo-2,5-se; D-threo-hexo-2,4-diulo-2,5-se; threo-hexo-2,4-diulo-2,5-se |
ChEMBL | |
DrugBank | |
ZINC | ZINC000058631711
|
PDB chain | 3l8h Chain C Residue 2006
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.1.3.82: D-glycero-beta-D-manno-heptose 1,7-bisphosphate 7-phosphatase. |
|
|
|