Structure of PDB 2rie Chain C Binding Site BS04 |
|
|
Ligand ID | 293 |
InChI | InChI=1S/C7H14O6/c8-2-4(10)7-6(12)3(9)1-5(11)13-7/h3-12H,1-2H2/t3-,4+,5+,6+,7-/m1/s1 |
InChIKey | XKBYYTRLKVABMB-PFCGLBSHSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.341 | OC[CH](O)[CH]1O[CH](O)C[CH](O)[CH]1O | CACTVS 3.341 | OC[C@H](O)[C@H]1O[C@H](O)C[C@@H](O)[C@@H]1O | ACDLabs 10.04 | OC1C(OC(O)CC1O)C(O)CO | OpenEye OEToolkits 1.5.0 | C1C(C(C(OC1O)C(CO)O)O)O | OpenEye OEToolkits 1.5.0 | C1[C@H]([C@@H]([C@H](O[C@@H]1O)[C@H](CO)O)O)O |
|
Formula | C7 H14 O6 |
Name | 2-deoxy-beta-L-galacto-heptopyranose; (2S,4R,5S,6R)-6-((S)-1,2-dihydroxyethyl)tetrahydro-2H-pyran-2,4,5-triol; 2-deoxy-L-glycero-D-manno-heptose; 2-deoxy-beta-L-galacto-heptose; 2-deoxy-L-galacto-heptose; 2-deoxy-galacto-heptose |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 2rie Chain C Residue 356
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|