Structure of PDB 8p67 Chain B Binding Site BS04 |
|
|
Ligand ID | GCV |
InChI | InChI=1S/C7H12O7/c1-13-4-2(8)3(9)7(12)14-5(4)6(10)11/h2-5,7-9,12H,1H3,(H,10,11)/t2-,3-,4+,5+,7+/m1/s1 |
InChIKey | WGLLPAPKWFDHHV-NRGGUMNKSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | COC1C(C(C(OC1C(=O)O)O)O)O | OpenEye OEToolkits 1.5.0 | CO[C@H]1[C@@H]([C@H]([C@H](O[C@@H]1C(=O)O)O)O)O | CACTVS 3.341 | CO[CH]1[CH](O)[CH](O)[CH](O)O[CH]1C(O)=O | CACTVS 3.341 | CO[C@H]1[C@H](O)[C@@H](O)[C@@H](O)O[C@@H]1C(O)=O | ACDLabs 10.04 | O=C(O)C1OC(O)C(O)C(O)C1OC |
|
Formula | C7 H12 O7 |
Name | 4-O-methyl-alpha-D-glucopyranuronic acid; 4-O-METHYL-ALPHA-D-GLUCURONIC ACID; 4-O-methyl-D-glucuronic acid; 4-O-methyl-glucuronic acid |
ChEMBL | CHEMBL187785 |
DrugBank | DB04303 |
ZINC |
|
PDB chain | 8p67 Chain F Residue 4
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|