Structure of PDB 5uas Chain B Binding Site BS04 |
|
|
Ligand ID | GCD |
InChI | InChI=1S/C6H8O6/c7-2-1-3(5(9)10)12-6(11)4(2)8/h1-2,4,6-8,11H,(H,9,10)/t2-,4+,6+/m0/s1 |
InChIKey | IAKKJSVSFCTLRY-YKKSOZKNSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | C1=C(OC(C(C1O)O)O)C(=O)O | CACTVS 3.370 | O[C@@H]1OC(=C[C@H](O)[C@H]1O)C(O)=O | CACTVS 3.370 | O[CH]1OC(=C[CH](O)[CH]1O)C(O)=O | OpenEye OEToolkits 1.7.6 | C1=C(O[C@H]([C@@H]([C@H]1O)O)O)C(=O)O | ACDLabs 12.01 | O=C(O)C=1OC(O)C(O)C(O)C=1 |
|
Formula | C6 H8 O6 |
Name | 4-deoxy-alpha-L-threo-hex-4-enopyranuronic acid; 4,5-DEHYDRO-D-GLUCURONIC ACID; 4-deoxy-alpha-L-threo-hex-4-enuronic acid; 4-deoxy-L-threo-hex-4-enuronic acid; 4-deoxy-threo-hex-4-enuronic acid |
ChEMBL | |
DrugBank | DB02305 |
ZINC |
|
PDB chain | 5uas Chain D Residue 4
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|