Structure of PDB 5ix0 Chain B Binding Site BS04 |
|
|
Ligand ID | 6EZ |
InChI | InChI=1S/C20H21FN2O2/c21-15-4-1-12(2-5-15)13-3-8-18(22)19(11-13)23-20(24)14-9-16-6-7-17(10-14)25-16/h1-5,8,11,14,16-17H,6-7,9-10,22H2,(H,23,24)/t14-,16-,17+ |
InChIKey | SBKJRDAJADZOCH-XGBSXSJOSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Nc1ccc(cc1NC(=O)[C@H]2C[C@@H]3CC[C@H](C2)O3)c4ccc(F)cc4 | ACDLabs 12.01 | c1(F)ccc(cc1)c2cc(c(cc2)N)NC(C3CC4CCC(C3)O4)=O | OpenEye OEToolkits 2.0.4 | c1cc(ccc1c2ccc(c(c2)NC(=O)C3CC4CCC(C3)O4)N)F | OpenEye OEToolkits 2.0.4 | c1cc(ccc1c2ccc(c(c2)NC(=O)C3C[C@H]4CC[C@@H](C3)O4)N)F | CACTVS 3.385 | Nc1ccc(cc1NC(=O)[CH]2C[CH]3CC[CH](C2)O3)c4ccc(F)cc4 |
|
Formula | C20 H21 F N2 O2 |
Name | (3-exo)-N-(4-amino-4'-fluoro[1,1'-biphenyl]-3-yl)-8-oxabicyclo[3.2.1]octane-3-carboxamide |
ChEMBL | CHEMBL3827611 |
DrugBank | |
ZINC | ZINC000584904847
|
PDB chain | 5ix0 Chain B Residue 404
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|