Structure of PDB 4nqa Chain B Binding Site BS04 |
|
|
Ligand ID | 965 |
InChI | InChI=1S/C33H31ClF3NO3/c34-32-27(15-8-17-30(32)33(35,36)37)22-38(18-9-19-41-28-16-7-10-24(20-28)21-31(39)40)23-29(25-11-3-1-4-12-25)26-13-5-2-6-14-26/h1-8,10-17,20,29H,9,18-19,21-23H2,(H,39,40) |
InChIKey | NAXSRXHZFIBFMI-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 11.02 | Clc1c(cccc1CN(CCCOc2cc(ccc2)CC(=O)O)CC(c3ccccc3)c4ccccc4)C(F)(F)F | CACTVS 3.352 | OC(=O)Cc1cccc(OCCCN(CC(c2ccccc2)c3ccccc3)Cc4cccc(c4Cl)C(F)(F)F)c1 | OpenEye OEToolkits 1.7.0 | c1ccc(cc1)C(CN(CCCOc2cccc(c2)CC(=O)O)Cc3cccc(c3Cl)C(F)(F)F)c4ccccc4 | OpenEye OEToolkits 1.7.0 | c1ccc(cc1)C(C[N@](CCCOc2cccc(c2)CC(=O)O)Cc3cccc(c3Cl)C(F)(F)F)c4ccccc4 |
|
Formula | C33 H31 Cl F3 N O3 |
Name | [3-(3-{[2-chloro-3-(trifluoromethyl)benzyl](2,2-diphenylethyl)amino}propoxy)phenyl]acetic acid |
ChEMBL | CHEMBL59030 |
DrugBank | DB03791 |
ZINC | ZINC000003966253
|
PDB chain | 4nqa Chain B Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|