Structure of PDB 4gqi Chain B Binding Site BS04 |
|
|
Ligand ID | M49 |
InChI | InChI=1S/C14H17N3O3/c1-8(18)15-6-5-11-12-7-10(16-9(2)19)3-4-13(12)17-14(11)20/h3-4,7,11H,5-6H2,1-2H3,(H,15,18)(H,16,19)(H,17,20)/t11-/m1/s1 |
InChIKey | AFKNIIZCTCAFIO-LLVKDONJSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=C(Nc1cc2c(cc1)NC(=O)C2CCNC(=O)C)C | OpenEye OEToolkits 1.7.6 | CC(=O)NCCC1c2cc(ccc2NC1=O)NC(=O)C | CACTVS 3.370 | CC(=O)NCC[C@H]1C(=O)Nc2ccc(NC(C)=O)cc12 | OpenEye OEToolkits 1.7.6 | CC(=O)NCC[C@@H]1c2cc(ccc2NC1=O)NC(=O)C | CACTVS 3.370 | CC(=O)NCC[CH]1C(=O)Nc2ccc(NC(C)=O)cc12 |
|
Formula | C14 H17 N3 O3 |
Name | N-{(3R)-3-[2-(acetylamino)ethyl]-2-oxo-2,3-dihydro-1H-indol-5-yl}acetamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000101597988
|
PDB chain | 4gqi Chain B Residue 303
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
G149 Y155 N161 |
Catalytic site (residue number reindexed from 1) |
G149 Y155 N161 |
Enzyme Commision number |
1.10.5.1: ribosyldihydronicotinamide dehydrogenase (quinone). |
|
|
|