Structure of PDB 3nlx Chain B Binding Site BS04 |
|
|
Ligand ID | 3XB |
InChI | InChI=1S/C21H27F3N4O/c1-14-7-18(28-20(25)8-14)9-15-11-27-12-19(15)29-6-5-26-13-21(23,24)16-3-2-4-17(22)10-16/h2-4,7-8,10,15,19,26-27H,5-6,9,11-13H2,1H3,(H2,25,28)/t15-,19+/m1/s1 |
InChIKey | IRAITVAESBBILD-BEFAXECRSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.0 | Cc1cc(nc(c1)N)C[C@@H]2CNC[C@@H]2OCCNCC(c3cccc(c3)F)(F)F | OpenEye OEToolkits 1.7.0 | Cc1cc(nc(c1)N)CC2CNCC2OCCNCC(c3cccc(c3)F)(F)F | CACTVS 3.370 | Cc1cc(N)nc(C[C@@H]2CNC[C@@H]2OCCNCC(F)(F)c3cccc(F)c3)c1 | CACTVS 3.370 | Cc1cc(N)nc(C[CH]2CNC[CH]2OCCNCC(F)(F)c3cccc(F)c3)c1 | ACDLabs 12.01 | Fc1cccc(c1)C(F)(F)CNCCOC2C(CNC2)Cc3nc(N)cc(c3)C |
|
Formula | C21 H27 F3 N4 O |
Name | 6-{[(3R,4R)-4-(2-{[2,2-difluoro-2-(3-fluorophenyl)ethyl]amino}ethoxy)pyrrolidin-3-yl]methyl}-4-methylpyridin-2-amine |
ChEMBL | CHEMBL1614782 |
DrugBank | |
ZINC | ZINC000049055295
|
PDB chain | 3nlx Chain B Residue 800
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|