Structure of PDB 7ko6 Chain A Binding Site BS04 |
|
|
Ligand ID | XP5 |
InChI | InChI=1S/C22H44NO8P/c1-6-8-10-12-14-21(24)28-18-20(31-22(25)15-13-11-9-7-2)19-30-32(26,27)29-17-16-23(3,4)5/h20H,6-19H2,1-5H3/p+1/t20-/m1/s1 |
InChIKey | RBFSPQDASPEAID-HXUWFJFHSA-O |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | CCCCCCC(=O)OCC(COP(=O)(O)OCC[N+](C)(C)C)OC(=O)CCCCCC | CACTVS 3.341 | CCCCCCC(=O)OC[CH](CO[P](O)(=O)OCC[N+](C)(C)C)OC(=O)CCCCCC | ACDLabs 10.04 | O=C(OCC(OC(=O)CCCCCC)COP(=O)(OCC[N+](C)(C)C)O)CCCCCC | OpenEye OEToolkits 1.5.0 | CCCCCCC(=O)OC[C@H](CO[P@@](=O)(O)OCC[N+](C)(C)C)OC(=O)CCCCCC | CACTVS 3.341 | CCCCCCC(=O)OC[C@H](CO[P@](O)(=O)OCC[N+](C)(C)C)OC(=O)CCCCCC |
|
Formula | C22 H45 N O8 P |
Name | (4S,7R)-7-(heptanoyloxy)-4-hydroxy-N,N,N-trimethyl-10-oxo-3,5,9-trioxa-4-phosphahexadecan-1-aminium 4-oxide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000013544783
|
PDB chain | 7ko6 Chain A Residue 304
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
2.7.11.13: protein kinase C. |
|
|