Structure of PDB 7jy1 Chain A Binding Site BS04 |
|
|
Ligand ID | VOP |
InChI | InChI=1S/C23H19FN6O3/c1-13(33-21-9-14-7-16(24)3-4-18(14)28-23(21)25)17-10-19-15(11-27-30(19)12-22(31)32)8-20(17)29-6-2-5-26-29/h2-11,13H,12H2,1H3,(H2,25,28)(H,31,32)/t13-/m0/s1 |
InChIKey | WCNGWEDHZJYDQQ-ZDUSSCGKSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | C[C@H](Oc1cc2cc(F)ccc2nc1N)c3cc4n(CC(O)=O)ncc4cc3n5cccn5 | ACDLabs 12.01 | c1c(c(cc2cnn(c12)CC(O)=O)n3nccc3)C(C)Oc4c(nc5c(c4)cc(cc5)F)N | CACTVS 3.385 | C[CH](Oc1cc2cc(F)ccc2nc1N)c3cc4n(CC(O)=O)ncc4cc3n5cccn5 | OpenEye OEToolkits 2.0.7 | CC(c1cc2c(cc1n3cccn3)cnn2CC(=O)O)Oc4cc5cc(ccc5nc4N)F | OpenEye OEToolkits 2.0.7 | C[C@@H](c1cc2c(cc1n3cccn3)cnn2CC(=O)O)Oc4cc5cc(ccc5nc4N)F |
|
Formula | C23 H19 F N6 O3 |
Name | [6-{(1S)-1-[(2-amino-6-fluoroquinolin-3-yl)oxy]ethyl}-5-(1H-pyrazol-1-yl)-1H-indazol-1-yl]acetic acid |
ChEMBL | CHEMBL4778770 |
DrugBank | |
ZINC |
|
PDB chain | 7jy1 Chain C Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|