Structure of PDB 7jy0 Chain A Binding Site BS04 |
|
|
Ligand ID | VOM |
InChI | InChI=1S/C21H18FN5O2/c1-12(16-11-15(22)4-6-18(16)27-8-2-7-25-27)29-19-10-14-9-13(21(24)28)3-5-17(14)26-20(19)23/h2-12H,1H3,(H2,23,26)(H2,24,28)/t12-/m0/s1 |
InChIKey | NWHCWMITPAFCOH-LBPRGKRZSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | C[CH](Oc1cc2cc(ccc2nc1N)C(N)=O)c3cc(F)ccc3n4cccn4 | ACDLabs 12.01 | c1c(c(ccc1F)n2nccc2)C(Oc4c(nc3c(cc(cc3)C(N)=O)c4)N)C | OpenEye OEToolkits 2.0.7 | C[C@@H](c1cc(ccc1n2cccn2)F)Oc3cc4cc(ccc4nc3N)C(=O)N | CACTVS 3.385 | C[C@H](Oc1cc2cc(ccc2nc1N)C(N)=O)c3cc(F)ccc3n4cccn4 | OpenEye OEToolkits 2.0.7 | CC(c1cc(ccc1n2cccn2)F)Oc3cc4cc(ccc4nc3N)C(=O)N |
|
Formula | C21 H18 F N5 O2 |
Name | 2-amino-3-{(1S)-1-[5-fluoro-2-(1H-pyrazol-1-yl)phenyl]ethoxy}quinoline-6-carboxamide |
ChEMBL | CHEMBL4783261 |
DrugBank | |
ZINC |
|
PDB chain | 7jy0 Chain A Residue 205
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|