Structure of PDB 6usc Chain A Binding Site BS04 |
|
|
Ligand ID | KO2 |
InChI | InChI=1S/C11H18O9/c1-2-3-19-11(10(17)18)9(16)7(15)6(14)8(20-11)5(13)4-12/h2,5-9,12-16H,1,3-4H2,(H,17,18)/t5-,6-,7+,8-,9+,11-/m1/s1 |
InChIKey | MJWRJGHIYDIAQR-RUEXUQCSSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.341 | OC[CH](O)[CH]1O[C](OCC=C)([CH](O)[CH](O)[CH]1O)C(O)=O | CACTVS 3.341 | OC[C@@H](O)[C@H]1O[C@](OCC=C)([C@@H](O)[C@@H](O)[C@H]1O)C(O)=O | OpenEye OEToolkits 1.5.0 | C=CCO[C@@]1([C@H]([C@H]([C@H]([C@H](O1)[C@@H](CO)O)O)O)O)C(=O)O | OpenEye OEToolkits 1.5.0 | C=CCOC1(C(C(C(C(O1)C(CO)O)O)O)O)C(=O)O | ACDLabs 10.04 | O=C(O)C1(OC\C=C)OC(C(O)CO)C(O)C(O)C1O |
|
Formula | C11 H18 O9 |
Name | prop-2-en-1-yl D-glycero-alpha-D-talo-oct-2-ulopyranosidonic acid; prop-2-en-1-yl D-glycero-alpha-D-talo-oct-2-ulosidonic acid; prop-2-en-1-yl D-glycero-D-talo-oct-2-ulosidonic acid; prop-2-en-1-yl D-glycero-talo-oct-2-ulosidonic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000058638803
|
PDB chain | 6usc Chain A Residue 404
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|