Structure of PDB 6jka Chain A Binding Site BS04 |
|
|
Ligand ID | BS0 |
InChI | InChI=1S/C19H16N2O2S/c22-18-9-7-13-10-14(6-8-16(13)20-18)17-12-24-19(21-17)11-23-15-4-2-1-3-5-15/h1-6,8,10,12H,7,9,11H2,(H,20,22) |
InChIKey | QXHYTMRDSBLWLI-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | O=C1CCc2cc(ccc2N1)c3csc(COc4ccccc4)n3 | OpenEye OEToolkits 2.0.6 | c1ccc(cc1)OCc2nc(cs2)c3ccc4c(c3)CCC(=O)N4 |
|
Formula | C19 H16 N2 O2 S |
Name | 6-[2-(phenoxymethyl)-1,3-thiazol-4-yl]-3,4-dihydro-1H-quinolin-2-one |
ChEMBL | |
DrugBank | |
ZINC | ZINC000008042381
|
PDB chain | 6jka Chain C Residue 303
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|