Structure of PDB 6ab8 Chain A Binding Site BS04 |
|
|
Ligand ID | 9VC |
InChI | InChI=1S/C14H20N2O4/c15-12(13(17)18)8-4-5-9-16-14(19)20-10-11-6-2-1-3-7-11/h1-3,6-7,12H,4-5,8-10,15H2,(H,16,19)(H,17,18)/t12-/m0/s1 |
InChIKey | CKGCFBNYQJDIGS-LBPRGKRZSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | c1ccc(cc1)COC(=O)NCCCCC(C(=O)O)N | OpenEye OEToolkits 2.0.6 | c1ccc(cc1)COC(=O)NCCCC[C@@H](C(=O)O)N | CACTVS 3.385 | N[CH](CCCCNC(=O)OCc1ccccc1)C(O)=O | CACTVS 3.385 | N[C@@H](CCCCNC(=O)OCc1ccccc1)C(O)=O |
|
Formula | C14 H20 N2 O4 |
Name | (2S)-2-azanyl-6-(phenylmethoxycarbonylamino)hexanoic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000002049231
|
PDB chain | 6ab8 Chain A Residue 506
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
6.1.1.26: pyrrolysine--tRNA(Pyl) ligase. |
|
|
|