Structure of PDB 6ab2 Chain A Binding Site BS04 |
|
|
Ligand ID | 9V6 |
InChI | InChI=1S/C14H19ClN2O4/c15-11-6-2-1-5-10(11)9-21-14(20)17-8-4-3-7-12(16)13(18)19/h1-2,5-6,12H,3-4,7-9,16H2,(H,17,20)(H,18,19)/t12-/m0/s1 |
InChIKey | YCQVFPIEKSYHFI-LBPRGKRZSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | c1ccc(c(c1)COC(=O)NCCCCC(C(=O)O)N)Cl | OpenEye OEToolkits 2.0.6 | c1ccc(c(c1)COC(=O)NCCCC[C@@H](C(=O)O)N)Cl | CACTVS 3.385 | N[C@@H](CCCCNC(=O)OCc1ccccc1Cl)C(O)=O | CACTVS 3.385 | N[CH](CCCCNC(=O)OCc1ccccc1Cl)C(O)=O |
|
Formula | C14 H19 Cl N2 O4 |
Name | (2S)-2-azanyl-6-[(2-chlorophenyl)methoxycarbonylamino]hexanoic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000002556571
|
PDB chain | 6ab2 Chain A Residue 506
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
6.1.1.26: pyrrolysine--tRNA(Pyl) ligase. |
|
|
|