Structure of PDB 5u84 Chain A Binding Site BS04 |
|
|
Ligand ID | I3C |
InChI | InChI=1S/C8H4I3NO4/c9-3-1(7(13)14)4(10)6(12)5(11)2(3)8(15)16/h12H2,(H,13,14)(H,15,16) |
InChIKey | JEZJSNULLBSYHV-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | c1(c(c(c(c(c1I)N)I)C(=O)O)I)C(=O)O | CACTVS 3.341 | Nc1c(I)c(C(O)=O)c(I)c(C(O)=O)c1I | ACDLabs 10.04 | Ic1c(C(=O)O)c(I)c(c(I)c1N)C(=O)O |
|
Formula | C8 H4 I3 N O4 |
Name | 5-amino-2,4,6-triiodobenzene-1,3-dicarboxylic acid; 5-Amino-2,4,6-triiodoisophthalic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000004806327
|
PDB chain | 5u84 Chain A Residue 410
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|