Structure of PDB 5lyd Chain A Binding Site BS04 |
|
|
Ligand ID | 7B0 |
InChI | InChI=1S/C6H15N3O4S/c7-4-2-1-3-5(6(10)11)9-14(8,12)13/h5,9H,1-4,7H2,(H,10,11)(H2,8,12,13)/t5-/m0/s1 |
InChIKey | IASBEZUWLDLXMF-YFKPBYRVSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | C(CCN)CC(C(=O)O)NS(=O)(=O)N | OpenEye OEToolkits 2.0.6 | C(CCN)C[C@@H](C(=O)O)NS(=O)(=O)N | CACTVS 3.385 | NCCCC[CH](N[S](N)(=O)=O)C(O)=O | CACTVS 3.385 | NCCCC[C@H](N[S](N)(=O)=O)C(O)=O |
|
Formula | C6 H15 N3 O4 S |
Name | (2~{S})-6-azanyl-2-(sulfamoylamino)hexanoic acid |
ChEMBL | CHEMBL3977994 |
DrugBank | |
ZINC | ZINC000147654029
|
PDB chain | 5lyd Chain A Residue 406
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|