Structure of PDB 5i8b Chain A Binding Site BS04 |
|
|
Ligand ID | 69F |
InChI | InChI=1S/C23H22N2O2/c1-16-13-22(26)25-21-12-6-11-20(23(21)24-16)18-9-5-10-19(14-18)27-15-17-7-3-2-4-8-17/h2-12,14,16,24H,13,15H2,1H3,(H,25,26)/t16-/m1/s1 |
InChIKey | XKIQUMIGIBMUJB-MRXNPFEDSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.4 | CC1CC(=O)Nc2cccc(c2N1)c3cccc(c3)OCc4ccccc4 | CACTVS 3.385 | C[CH]1CC(=O)Nc2cccc(c2N1)c3cccc(OCc4ccccc4)c3 | CACTVS 3.385 | C[C@@H]1CC(=O)Nc2cccc(c2N1)c3cccc(OCc4ccccc4)c3 | ACDLabs 12.01 | C4C(C)Nc3c(cccc3c1cccc(c1)OCc2ccccc2)NC4=O | OpenEye OEToolkits 2.0.4 | C[C@@H]1CC(=O)Nc2cccc(c2N1)c3cccc(c3)OCc4ccccc4 |
|
Formula | C23 H22 N2 O2 |
Name | (4R)-6-[3-(benzyloxy)phenyl]-4-methyl-1,3,4,5-tetrahydro-2H-1,5-benzodiazepin-2-one |
ChEMBL | CHEMBL3813846 |
DrugBank | |
ZINC | ZINC000584904928
|
PDB chain | 5i8b Chain A Residue 1404
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|