Structure of PDB 5g68 Chain A Binding Site BS04 |
|
|
Ligand ID | ML6 |
InChI | InChI=1S/C19H20FN3/c20-17-5-1-3-14(11-17)4-2-10-22-13-15-6-7-16-8-9-19(21)23-18(16)12-15/h1,3,5-9,11-12,22H,2,4,10,13H2,(H2,21,23) |
InChIKey | QIPUHKWELQSESM-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | c1cc(cc(c1)F)CCCNCc2ccc3ccc(nc3c2)N | CACTVS 3.385 | Nc1ccc2ccc(CNCCCc3cccc(F)c3)cc2n1 | ACDLabs 12.01 | Fc1cccc(c1)CCCNCc2cc3nc(ccc3cc2)N |
|
Formula | C19 H20 F N3 |
Name | 7-({[3-(3-fluorophenyl)propyl]amino}methyl)quinolin-2-amine |
ChEMBL | CHEMBL3139608 |
DrugBank | |
ZINC | ZINC000098209181
|
PDB chain | 5g68 Chain A Residue 905
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|