Structure of PDB 5fyb Chain A Binding Site BS04 |
|
|
Ligand ID | 77J |
InChI | InChI=1S/C13H13N3O3S/c17-11(16-19)6-7-20-13-14-10(8-12(18)15-13)9-4-2-1-3-5-9/h1-5,8,19H,6-7H2,(H,16,17)(H,14,15,18) |
InChIKey | WNPFBIDOQFZHQF-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | c1ccc(cc1)C2=CC(=O)NC(=N2)SCCC(=O)NO | ACDLabs 12.01 | C=1(NC(=O)C=C(N=1)c2ccccc2)SCCC(NO)=O | CACTVS 3.385 | ONC(=O)CCSC1=NC(=CC(=O)N1)c2ccccc2 |
|
Formula | C13 H13 N3 O3 S |
Name | N-hydroxy-3-[(6-oxo-4-phenyl-1,6-dihydropyrimidin-2-yl)sulfanyl]propanamide |
ChEMBL | CHEMBL413733 |
DrugBank | |
ZINC | ZINC000035050427
|
PDB chain | 5fyb Chain A Residue 1760
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|