Structure of PDB 4i0g Chain A Binding Site BS04 |
|
|
Ligand ID | 1B9 |
InChI | InChI=1S/C18H18BrClN2O2S/c1-18(2)7-10-5-12(20)3-4-13(10)16(22-18)21-15(17(23)24)6-11-8-25-9-14(11)19/h3-5,8-9,15H,6-7H2,1-2H3,(H,21,22)(H,23,24)/t15-/m0/s1 |
InChIKey | LZMNPXMCRBRYAN-HNNXBMFYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | Brc1c(csc1)CC(NC3=NC(C)(C)Cc2cc(Cl)ccc23)C(=O)O | OpenEye OEToolkits 1.7.6 | CC1(Cc2cc(ccc2C(=N1)NC(Cc3cscc3Br)C(=O)O)Cl)C | OpenEye OEToolkits 1.7.6 | CC1(Cc2cc(ccc2C(=N1)N[C@@H](Cc3cscc3Br)C(=O)O)Cl)C | CACTVS 3.370 | CC1(C)Cc2cc(Cl)ccc2C(=N1)N[CH](Cc3cscc3Br)C(O)=O | CACTVS 3.370 | CC1(C)Cc2cc(Cl)ccc2C(=N1)N[C@@H](Cc3cscc3Br)C(O)=O |
|
Formula | C18 H18 Br Cl N2 O2 S |
Name | 3-(4-bromothiophen-3-yl)-N-(6-chloro-3,3-dimethyl-3,4-dihydroisoquinolin-1-yl)-L-alanine |
ChEMBL | |
DrugBank | |
ZINC | ZINC000095921046
|
PDB chain | 4i0g Chain A Residue 504
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|