Structure of PDB 4i0f Chain A Binding Site BS04 |
|
|
Ligand ID | 1BF |
InChI | InChI=1S/C21H21ClN4O2S/c1-21(2)7-12-5-15(22)3-4-16(12)19(26-21)25-18(20(27)28)6-13-10-29-11-17(13)14-8-23-24-9-14/h3-5,8-11,18H,6-7H2,1-2H3,(H,23,24)(H,25,26)(H,27,28)/t18-/m0/s1 |
InChIKey | ASNJXTHXWLJRAC-SFHVURJKSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | CC1(Cc2cc(ccc2C(=N1)NC(Cc3cscc3c4c[nH]nc4)C(=O)O)Cl)C | CACTVS 3.370 | CC1(C)Cc2cc(Cl)ccc2C(=N1)N[CH](Cc3cscc3c4c[nH]nc4)C(O)=O | CACTVS 3.370 | CC1(C)Cc2cc(Cl)ccc2C(=N1)N[C@@H](Cc3cscc3c4c[nH]nc4)C(O)=O | ACDLabs 12.01 | O=C(O)C(NC2=NC(C)(C)Cc1cc(Cl)ccc12)Cc4cscc4c3cnnc3 | OpenEye OEToolkits 1.7.6 | CC1(Cc2cc(ccc2C(=N1)N[C@@H](Cc3cscc3c4c[nH]nc4)C(=O)O)Cl)C |
|
Formula | C21 H21 Cl N4 O2 S |
Name | N-(6-chloro-3,3-dimethyl-3,4-dihydroisoquinolin-1-yl)-3-[4-(1H-pyrazol-4-yl)thiophen-3-yl]-L-alanine |
ChEMBL | |
DrugBank | |
ZINC | ZINC000095921047
|
PDB chain | 4i0f Chain A Residue 504
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|