Structure of PDB 4i0e Chain A Binding Site BS04 |
|
|
Ligand ID | 1B8 |
InChI | InChI=1S/C21H20BrClN4O2S/c1-21(2)7-11-5-13(23)3-4-14(11)19(27-21)26-17(20(28)29)6-15-16(10-30-18(15)22)12-8-24-25-9-12/h3-5,8-10,17H,6-7H2,1-2H3,(H,24,25)(H,26,27)(H,28,29)/t17-/m0/s1 |
InChIKey | DZVYKFXCGGLAAX-KRWDZBQOSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | CC1(C)Cc2cc(Cl)ccc2C(=N1)N[C@@H](Cc3c(Br)scc3c4c[nH]nc4)C(O)=O | OpenEye OEToolkits 1.7.6 | CC1(Cc2cc(ccc2C(=N1)NC(Cc3c(csc3Br)c4c[nH]nc4)C(=O)O)Cl)C | CACTVS 3.370 | CC1(C)Cc2cc(Cl)ccc2C(=N1)N[CH](Cc3c(Br)scc3c4c[nH]nc4)C(O)=O | ACDLabs 12.01 | Brc1scc(c1CC(NC3=NC(C)(C)Cc2cc(Cl)ccc23)C(=O)O)c4cnnc4 | OpenEye OEToolkits 1.7.6 | CC1(Cc2cc(ccc2C(=N1)N[C@@H](Cc3c(csc3Br)c4c[nH]nc4)C(=O)O)Cl)C |
|
Formula | C21 H20 Br Cl N4 O2 S |
Name | 3-[2-bromo-4-(1H-pyrazol-4-yl)thiophen-3-yl]-N-(6-chloro-3,3-dimethyl-3,4-dihydroisoquinolin-1-yl)-L-alanine |
ChEMBL | |
DrugBank | |
ZINC | ZINC000098207937
|
PDB chain | 4i0e Chain A Residue 504
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|