Structure of PDB 4i0d Chain A Binding Site BS04 |
|
|
Ligand ID | 1B7 |
InChI | InChI=1S/C21H25ClN2O2S/c1-4-5-13-11-27-12-15(13)9-18(20(25)26)23-19-17-7-6-16(22)8-14(17)10-21(2,3)24-19/h6-8,11-12,18H,4-5,9-10H2,1-3H3,(H,23,24)(H,25,26)/t18-/m0/s1 |
InChIKey | SFUUSYIYAKSHRW-SFHVURJKSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=C(O)C(NC1=NC(C)(C)Cc2cc(Cl)ccc12)Cc3c(csc3)CCC | OpenEye OEToolkits 1.7.6 | CCCc1cscc1CC(C(=O)O)NC2=NC(Cc3c2ccc(c3)Cl)(C)C | CACTVS 3.370 | CCCc1cscc1C[C@H](NC2=NC(C)(C)Cc3cc(Cl)ccc23)C(O)=O | OpenEye OEToolkits 1.7.6 | CCCc1cscc1C[C@@H](C(=O)O)NC2=NC(Cc3c2ccc(c3)Cl)(C)C | CACTVS 3.370 | CCCc1cscc1C[CH](NC2=NC(C)(C)Cc3cc(Cl)ccc23)C(O)=O |
|
Formula | C21 H25 Cl N2 O2 S |
Name | N-(6-chloro-3,3-dimethyl-3,4-dihydroisoquinolin-1-yl)-3-(4-propylthiophen-3-yl)-L-alanine |
ChEMBL | |
DrugBank | |
ZINC | ZINC000095921212
|
PDB chain | 4i0d Chain A Residue 504
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|